8-methylquinoline-3-carboxylic acid
Catalog No: FT-0757966
CAS No: 71082-55-8
- Chemical Name: 8-methylquinoline-3-carboxylic acid
- Molecular Formula: C11H9NO2
- Molecular Weight: 187.19
- InChI Key: IKQVXJGBIGBKNW-UHFFFAOYSA-N
- InChI: InChI=1S/C11H9NO2/c1-7-3-2-4-8-5-9(11(13)14)6-12-10(7)8/h2-6H,1H3,(H,13,14)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 71082-55-8 |
|---|---|
| MF: | C11H9NO2 |
| Density: | 1.285g/cm3 |
| Flash_Point: | 172.6ºC |
| Melting_Point: | N/A |
| Product_Name: | 8-methylquinoline-3-carboxylic acid |
| Symbol: | GHS07 |
| Bolling_Point: | 361.8ºC at 760 mmHg |
| FW: | 187.19500 |
| Density: | 1.285g/cm3 |
|---|---|
| MF: | C11H9NO2 |
| LogP: | 2.24140 |
| Exact_Mass: | 187.06300 |
| Bolling_Point: | 361.8ºC at 760 mmHg |
| Flash_Point: | 172.6ºC |
| FW: | 187.19500 |
| Refractive_Index: | 1.663 |
| PSA: | 50.19000 |
| Safety_Statements: | H319 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| HS_Code: | 2933499090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)